About benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline
benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline (PubChem CID 175315106) has the molecular formula C24H22ClNO5S
and a molecular weight of 471.96 g/mol. Its IUPAC name is benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline.
Molecular Properties
| Compound Name | benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline |
| PubChem CID | 175315106 |
| Molecular Formula | C24H22ClNO5S |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C(Cl)OCc1ccccc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H7ClO2.C7H8O3S/c1-2-6-9-8(4-1)5-3-7-10-9;9-8(10)11-6-7-4-2-1-3-5-7;1-6-2-4-7(5-3-6)11(8,9)10/h1-7H;1-5H,6H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | GMGBIPRZGNTWSQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline?
The IUPAC name of benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline (CID 175315106) is benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline.
What is the SMILES notation for benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline?
The canonical SMILES for benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline is Cc1ccc(S(=O)(=O)O)cc1.O=C(Cl)OCc1ccccc1.c1ccc2ncccc2c1.
What is the InChIKey of benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline?
The InChIKey is GMGBIPRZGNTWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H7ClO2.C7H8O3S/c1-2-6-9-8(4-1)5-3-7-10-9;9-8(10)11-6-7-4-2-1-3-5-7;1-6-2-4-7(5-3-6)11(8,9)10/h1-7H;1-5H,6H2;2-5H,1H3,(H,8,9,10).
What are the key properties of benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline?
benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline has a molecular weight of 471.96 g/mol, XLogP of 6.04, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl carbonochloridate;4-methylbenzenesulfonic acid;quinoline is sourced from PubChem (CID 175315106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).