C20H21NS — CID 175319076
N,N-dimethyl-5-(2-phenylethylsulfanyl)naphthalen-1-amine (PubChem CID 175319076) has the molecular formula C20H21NS and a molecular weight of 307.46 g/mol. Its IUPAC name is N,N-dimethyl-5-(2-phenylethylsulfanyl)naphthalen-1-amine.
| Compound Name | N,N-dimethyl-5-(2-phenylethylsulfanyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 175319076 |
| Molecular Formula | C20H21NS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N,N-dimethyl-5-(2-phenylethylsulfanyl)naphthalen-1-amine |
| SMILES | CN(C)c1cccc2c(SCCc3ccccc3)cccc12 |
| InChI | InChI=1S/C20H21NS/c1-21(2)19-12-6-11-18-17(19)10-7-13-20(18)22-15-14-16-8-4-3-5-9-16/h3-13H,14-15H2,1-2H3 |
| InChIKey | BLLDYXAOSCKYMC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |