C11H12O7 — CID 175319500
4-(3-carboxybut-3-enoyloxy)-3-methyl-2-methylidene-4-oxobutanoic acid (PubChem CID 175319500) has the molecular formula C11H12O7 and a molecular weight of 256.21 g/mol. Its IUPAC name is 4-(3-carboxybut-3-enoyloxy)-3-methyl-2-methylidene-4-oxobutanoic acid.
| Compound Name | 4-(3-carboxybut-3-enoyloxy)-3-methyl-2-methylidene-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175319500 |
| Molecular Formula | C11H12O7 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-(3-carboxybut-3-enoyloxy)-3-methyl-2-methylidene-4-oxobutanoic acid |
| SMILES | C=C(CC(=O)OC(=O)C(C)C(=C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H12O7/c1-5(9(13)14)4-8(12)18-11(17)7(3)6(2)10(15)16/h7H,1-2,4H2,3H3,(H,13,14)(H,15,16) |
| InChIKey | LTJLWQVBOUUVOJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|