C9H10F6O2 — CID 175322006
2-(1,1,1,2,3,3-hexafluorohex-5-en-2-yloxymethyl)oxirane (PubChem CID 175322006) has the molecular formula C9H10F6O2 and a molecular weight of 264.17 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3-hexafluorohex-5-en-2-yloxymethyl)oxirane.
| Compound Name | 2-(1,1,1,2,3,3-hexafluorohex-5-en-2-yloxymethyl)oxirane |
|---|---|
| PubChem CID | 175322006 |
| Molecular Formula | C9H10F6O2 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(1,1,1,2,3,3-hexafluorohex-5-en-2-yloxymethyl)oxirane |
| SMILES | C=CCC(F)(F)C(F)(OCC1CO1)C(F)(F)F |
| InChI | InChI=1S/C9H10F6O2/c1-2-3-7(10,11)8(12,9(13,14)15)17-5-6-4-16-6/h2,6H,1,3-5H2 |
| InChIKey | CZHMIVWUZRBHAO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|