C28H64N2O7S — CID 175333954
bis(N-ethyl-N-methylethanamine);hexadecanoic acid;2-hydroxyethyl hydrogen sulfate (PubChem CID 175333954) has the molecular formula C28H64N2O7S and a molecular weight of 572.89 g/mol. Its IUPAC name is bis(N-ethyl-N-methylethanamine);hexadecanoic acid;2-hydroxyethyl hydrogen sulfate.
| Compound Name | bis(N-ethyl-N-methylethanamine);hexadecanoic acid;2-hydroxyethyl hydrogen sulfate |
|---|---|
| PubChem CID | 175333954 |
| Molecular Formula | C28H64N2O7S |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 572.44 |
| IUPAC Name | bis(N-ethyl-N-methylethanamine);hexadecanoic acid;2-hydroxyethyl hydrogen sulfate |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.CCN(C)CC.CCN(C)CC.O=S(=O)(O)OCCO |
| InChI | InChI=1S/C16H32O2.2C5H13N.C2H6O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;2*1-4-6(3)5-2;3-1-2-7-8(4,5)6/h2-15H2,1H3,(H,17,18);2*4-5H2,1-3H3;3H,1-2H2,(H,4,5,6) |
| InChIKey | SBTRRBNKIWLLDK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|