C15H19F2NO2 — CID 175348079
(3,5-difluorophenyl) N-tert-butyl-N-cyclobutylcarbamate (PubChem CID 175348079) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is (3,5-difluorophenyl) N-tert-butyl-N-cyclobutylcarbamate.
| Compound Name | (3,5-difluorophenyl) N-tert-butyl-N-cyclobutylcarbamate |
|---|---|
| PubChem CID | 175348079 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3,5-difluorophenyl) N-tert-butyl-N-cyclobutylcarbamate |
| SMILES | CC(C)(C)N(C(=O)Oc1cc(F)cc(F)c1)C1CCC1 |
| InChI | InChI=1S/C15H19F2NO2/c1-15(2,3)18(12-5-4-6-12)14(19)20-13-8-10(16)7-11(17)9-13/h7-9,12H,4-6H2,1-3H3 |
| InChIKey | FDHRKJYPKZAFCB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |