C26H24F7N5O3 — CID 175348800
N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-7-[2-(hydroxymethyl)-4-methylpiperazin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 175348800) has the molecular formula C26H24F7N5O3 and a molecular weight of 587.50 g/mol. Its IUPAC name is N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-7-[2-(hydroxymethyl)-4-methylpiperazin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-7-[2-(hydroxymethyl)-4-methylpiperazin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 175348800 |
| Molecular Formula | C26H24F7N5O3 |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-7-[2-(hydroxymethyl)-4-methylpiperazin-1-yl]-4-oxo-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CN1CCN(c2nc3c(cc2F)c(=O)c(C(=O)NC(F)(C(F)F)C2CC2)cn3-c2c(F)cc(F)cc2F)C(CO)C1 |
| InChI | InChI=1S/C26H24F7N5O3/c1-36-4-5-37(14(9-36)11-39)23-19(30)8-15-21(40)16(24(41)35-26(33,25(31)32)12-2-3-12)10-38(22(15)34-23)20-17(28)6-13(27)7-18(20)29/h6-8,10,12,14,25,39H,2-5,9,11H2,1H3,(H,35,41) |
| InChIKey | OFJYAYQVMLVCOI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|