C26H23F5N4O4 — CID 175348786
N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 175348786) has the molecular formula C26H23F5N4O4 and a molecular weight of 550.48 g/mol. Its IUPAC name is N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 175348786 |
| Molecular Formula | C26H23F5N4O4 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | N-(1-cyclopropyl-1,2,2-trifluoroethyl)-6-fluoro-1-(4-fluoro-2,6-dimethylphenyl)-7-[(4S)-4-hydroxy-2-oxopyrrolidin-1-yl]-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1cc(F)cc(C)c1-n1cc(C(=O)NC(F)(C(F)F)C2CC2)c(=O)c2cc(F)c(N3C[C@@H](O)CC3=O)nc21 |
| InChI | InChI=1S/C26H23F5N4O4/c1-11-5-14(27)6-12(2)20(11)35-10-17(24(39)33-26(31,25(29)30)13-3-4-13)21(38)16-8-18(28)23(32-22(16)35)34-9-15(36)7-19(34)37/h5-6,8,10,13,15,25,36H,3-4,7,9H2,1-2H3,(H,33,39)/t15-,26?/m0/s1 |
| InChIKey | GAXNGVNAOHLXHG-DKJAIQOISA-N |
| XLogP | 3.45 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|