C41H41N6O9S- — CID 175348917
4-[3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylamino]-3-oxopropyl]-6-(2-methoxy-N-sulfinatoanilino)-1-methyl-2-oxobenzo[cd]indole (PubChem CID 175348917) has the molecular formula C41H41N6O9S- and a molecular weight of 793.88 g/mol. Its IUPAC name is 4-[3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylamino]-3-oxopropyl]-6-(2-methoxy-N-sulfinatoanilino)-1-methyl-2-oxobenzo[cd]indole.
| Compound Name | 4-[3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylamino]-3-oxopropyl]-6-(2-methoxy-N-sulfinatoanilino)-1-methyl-2-oxobenzo[cd]indole |
|---|---|
| PubChem CID | 175348917 |
| Molecular Formula | C41H41N6O9S- |
| Molecular Weight | 793.88 g/mol |
| Exact Mass | 793.27 |
| IUPAC Name | 4-[3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexylamino]-3-oxopropyl]-6-(2-methoxy-N-sulfinatoanilino)-1-methyl-2-oxobenzo[cd]indole |
| SMILES | COc1ccccc1N(c1ccc2c3c(cc(CCC(=O)NCCCCCCNc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)cc13)C(=O)N2C)S(=O)[O-] |
| InChI | InChI=1S/C41H42N6O9S/c1-45-31-16-15-29(47(57(54)55)30-12-5-6-13-33(30)56-2)26-22-24(23-27(36(26)31)39(45)51)14-18-34(48)43-21-8-4-3-7-20-42-28-11-9-10-25-37(28)41(53)46(40(25)52)32-17-19-35(49)44-38(32)50/h5-6,9-13,15-16,22-23,32,42H,3-4,7-8,14,17-21H2,1-2H3,(H,43,48)(H,54,55)(H,44,49,50)/p-1 |
| InChIKey | RXACMEAISIHQOI-UHFFFAOYSA-M |
| XLogP | 4.49 |
| TPSA | 197.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|