C27H51N3O2 — CID 175351975
azane;2-[4-dodec-2-enyl-1-(1,2,2,3-tetramethylpiperidin-4-yl)pyrrolidin-2-yl]-2-oxoacetaldehyde (PubChem CID 175351975) has the molecular formula C27H51N3O2 and a molecular weight of 449.72 g/mol. Its IUPAC name is azane;2-[4-dodec-2-enyl-1-(1,2,2,3-tetramethylpiperidin-4-yl)pyrrolidin-2-yl]-2-oxoacetaldehyde.
| Compound Name | azane;2-[4-dodec-2-enyl-1-(1,2,2,3-tetramethylpiperidin-4-yl)pyrrolidin-2-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 175351975 |
| Molecular Formula | C27H51N3O2 |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.40 |
| IUPAC Name | azane;2-[4-dodec-2-enyl-1-(1,2,2,3-tetramethylpiperidin-4-yl)pyrrolidin-2-yl]-2-oxoacetaldehyde |
| SMILES | CCCCCCCCCC=CCC1CC(C(=O)C=O)N(C2CCN(C)C(C)(C)C2C)C1.N |
| InChI | InChI=1S/C27H48N2O2.H3N/c1-6-7-8-9-10-11-12-13-14-15-16-23-19-25(26(31)21-30)29(20-23)24-17-18-28(5)27(3,4)22(24)2;/h14-15,21-25H,6-13,16-20H2,1-5H3;1H3 |
| InChIKey | HHBKXEZSMZSKLI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|