C16H14O7 — CID 175352859
4-(3,5-dimethoxyphenyl)-2-oxocyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 175352859) has the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-2-oxocyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 4-(3,5-dimethoxyphenyl)-2-oxocyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175352859 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-2-oxocyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | COc1cc(OC)cc(C2=C(C(=O)O)C(=O)C(C(=O)O)C=C2)c1 |
| InChI | InChI=1S/C16H14O7/c1-22-9-5-8(6-10(7-9)23-2)11-3-4-12(15(18)19)14(17)13(11)16(20)21/h3-7,12H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | YZBXGILNIUNIQB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|