C18H16F3NO2 — CID 175360076
[4-(2,3,4-trifluorophenyl)phenyl] piperidine-1-carboxylate (PubChem CID 175360076) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is [4-(2,3,4-trifluorophenyl)phenyl] piperidine-1-carboxylate.
| Compound Name | [4-(2,3,4-trifluorophenyl)phenyl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175360076 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [4-(2,3,4-trifluorophenyl)phenyl] piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(-c2ccc(F)c(F)c2F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H16F3NO2/c19-15-9-8-14(16(20)17(15)21)12-4-6-13(7-5-12)24-18(23)22-10-2-1-3-11-22/h4-9H,1-3,10-11H2 |
| InChIKey | LRWXFDSRXHWORT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|