C15H17N2O9S- — CID 175367092
[[(5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidin-5-yl]-(3-nitrophenyl)methyl] sulfite (PubChem CID 175367092) has the molecular formula C15H17N2O9S- and a molecular weight of 401.37 g/mol. Its IUPAC name is [[(5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidin-5-yl]-(3-nitrophenyl)methyl] sulfite.
| Compound Name | [[(5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidin-5-yl]-(3-nitrophenyl)methyl] sulfite |
|---|---|
| PubChem CID | 175367092 |
| Molecular Formula | C15H17N2O9S- |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [[(5S)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-oxazolidin-5-yl]-(3-nitrophenyl)methyl] sulfite |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C(OS(=O)[O-])c2cccc([N+](=O)[O-])c2)OC1=O |
| InChI | InChI=1S/C15H18N2O9S/c1-15(2,3)25-14(19)16-8-11(24-13(16)18)12(26-27(22)23)9-5-4-6-10(7-9)17(20)21/h4-7,11-12H,8H2,1-3H3,(H,22,23)/p-1/t11-,12?/m0/s1 |
| InChIKey | DURQXJUGHJKQDV-PXYINDEMSA-M |
| XLogP | 2.20 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|