C31H40N6O5S — CID 175380873
tert-butyl (3R)-3-[[(3R,4R,5R,7R)-5,7,11-triamino-7-(6-cyclobutyloxy-3-pyridinyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 175380873) has the molecular formula C31H40N6O5S and a molecular weight of 608.77 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(3R,4R,5R,7R)-5,7,11-triamino-7-(6-cyclobutyloxy-3-pyridinyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[(3R,4R,5R,7R)-5,7,11-triamino-7-(6-cyclobutyloxy-3-pyridinyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175380873 |
| Molecular Formula | C31H40N6O5S |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | tert-butyl (3R)-3-[[(3R,4R,5R,7R)-5,7,11-triamino-7-(6-cyclobutyloxy-3-pyridinyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NC(=O)[C@@H]2Sc3c(N)ccc4c3[C@@H]2[C@@H](N)C(=O)[C@]4(N)c2ccc(OC3CCC3)nc2)C1 |
| InChI | InChI=1S/C31H40N6O5S/c1-30(2,3)42-29(40)37-13-5-6-17(15-37)36-28(39)26-23-22-19(10-11-20(32)25(22)43-26)31(34,27(38)24(23)33)16-9-12-21(35-14-16)41-18-7-4-8-18/h9-12,14,17-18,23-24,26H,4-8,13,15,32-34H2,1-3H3,(H,36,39)/t17-,23-,24-,26-,31+/m1/s1 |
| InChIKey | UWWILEQBEMGOTJ-CHZYGNLYSA-N |
| XLogP | 2.78 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|