C29H31N5O3S — CID 175146419
5,7,11-triamino-3-(3-aminopyrrolidine-1-carbonyl)-7-(2-methyl-4-phenoxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-6-one (PubChem CID 175146419) has the molecular formula C29H31N5O3S and a molecular weight of 529.67 g/mol. Its IUPAC name is 5,7,11-triamino-3-(3-aminopyrrolidine-1-carbonyl)-7-(2-methyl-4-phenoxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-6-one.
| Compound Name | 5,7,11-triamino-3-(3-aminopyrrolidine-1-carbonyl)-7-(2-methyl-4-phenoxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-6-one |
|---|---|
| PubChem CID | 175146419 |
| Molecular Formula | C29H31N5O3S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 5,7,11-triamino-3-(3-aminopyrrolidine-1-carbonyl)-7-(2-methyl-4-phenoxyphenyl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-6-one |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)C2c3c1ccc(N)c3SC2C(=O)N1CCC(N)C1 |
| InChI | InChI=1S/C29H31N5O3S/c1-15-13-18(37-17-5-3-2-4-6-17)7-8-19(15)29(33)20-9-10-21(31)25-22(20)23(24(32)27(29)35)26(38-25)28(36)34-12-11-16(30)14-34/h2-10,13,16,23-24,26H,11-12,14,30-33H2,1H3 |
| InChIKey | HCTKUGONXOXQQO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 150.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|