C20H21N3O4S — CID 175303246
5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxylic acid (PubChem CID 175303246) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxylic acid.
| Compound Name | 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 175303246 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 5,7,11-triamino-7-(4-methoxy-2-methylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxylic acid |
| SMILES | COc1ccc(C2(N)C(=O)C(N)C3c4c2ccc(N)c4SC3C(=O)O)c(C)c1 |
| InChI | InChI=1S/C20H21N3O4S/c1-8-7-9(27-2)3-4-10(8)20(23)11-5-6-12(21)16-13(11)14(15(22)18(20)24)17(28-16)19(25)26/h3-7,14-15,17H,21-23H2,1-2H3,(H,25,26) |
| InChIKey | RZNDZLZDPLFRIB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|