C25H24N4O4S — CID 175140820
[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl] carbamate (PubChem CID 175140820) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is [5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl] carbamate.
| Compound Name | [5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl] carbamate |
|---|---|
| PubChem CID | 175140820 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-yl] carbamate |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)C2c3c1ccc(N)c3SC2OC(N)=O |
| InChI | InChI=1S/C25H24N4O4S/c1-12-11-14(32-13-5-3-2-4-6-13)7-8-15(12)25(29)16-9-10-17(26)21-18(16)19(20(27)22(25)30)23(34-21)33-24(28)31/h2-11,19-20,23H,26-27,29H2,1H3,(H2,28,31) |
| InChIKey | MLMQLQNFIYPDHL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|