C33H36N6O6S — CID 175138044
[2-oxo-2-[[(1R,3S)-3-[[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl]amino]ethyl] carbamate (PubChem CID 175138044) has the molecular formula C33H36N6O6S and a molecular weight of 644.75 g/mol. Its IUPAC name is [2-oxo-2-[[(1R,3S)-3-[[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl]amino]ethyl] carbamate.
| Compound Name | [2-oxo-2-[[(1R,3S)-3-[[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl]amino]ethyl] carbamate |
|---|---|
| PubChem CID | 175138044 |
| Molecular Formula | C33H36N6O6S |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | [2-oxo-2-[[(1R,3S)-3-[[5,7,11-triamino-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carbonyl]amino]cyclopentyl]amino]ethyl] carbamate |
| SMILES | Cc1cc(Oc2ccccc2)ccc1C1(N)C(=O)C(N)C2c3c1ccc(N)c3SC2C(=O)N[C@H]1CC[C@@H](NC(=O)COC(N)=O)C1 |
| InChI | InChI=1S/C33H36N6O6S/c1-16-13-20(45-19-5-3-2-4-6-19)9-10-21(16)33(37)22-11-12-23(34)28-25(22)26(27(35)30(33)41)29(46-28)31(42)39-18-8-7-17(14-18)38-24(40)15-44-32(36)43/h2-6,9-13,17-18,26-27,29H,7-8,14-15,34-35,37H2,1H3,(H2,36,43)(H,38,40)(H,39,42)/t17-,18+,26?,27?,29?,33?/m1/s1 |
| InChIKey | TVASYLUBUCQKPR-VEWUZDFNSA-N |
| XLogP | 2.29 |
| TPSA | 214.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|