C12H13N5O3 — CID 175381746
N'-amino-1-oxidopyridin-1-ium-4-carboximidamide;pyridine-4-carboxylic acid (PubChem CID 175381746) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is N'-amino-1-oxidopyridin-1-ium-4-carboximidamide;pyridine-4-carboxylic acid.
| Compound Name | N'-amino-1-oxidopyridin-1-ium-4-carboximidamide;pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 175381746 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N'-amino-1-oxidopyridin-1-ium-4-carboximidamide;pyridine-4-carboxylic acid |
| SMILES | NN=C(N)c1cc[n+]([O-])cc1.O=C(O)c1ccncc1 |
| InChI | InChI=1S/C6H8N4O.C6H5NO2/c7-6(9-8)5-1-3-10(11)4-2-5;8-6(9)5-1-3-7-4-2-5/h1-4H,8H2,(H2,7,9);1-4H,(H,8,9) |
| InChIKey | TUZCVEFBFHUROR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|