C14H18N2O3 — CID 175382214
3-hydroxy-3-methoxy-3-(4-morpholin-4-ylphenyl)propanenitrile (PubChem CID 175382214) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-hydroxy-3-methoxy-3-(4-morpholin-4-ylphenyl)propanenitrile.
| Compound Name | 3-hydroxy-3-methoxy-3-(4-morpholin-4-ylphenyl)propanenitrile |
|---|---|
| PubChem CID | 175382214 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-hydroxy-3-methoxy-3-(4-morpholin-4-ylphenyl)propanenitrile |
| SMILES | COC(O)(CC#N)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-18-14(17,6-7-15)12-2-4-13(5-3-12)16-8-10-19-11-9-16/h2-5,17H,6,8-11H2,1H3 |
| InChIKey | QUSHQVNNJXTZRX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|