C12H20F3NO3 — CID 175385000
2-carbamoylnonyl 2,2,2-trifluoroacetate (PubChem CID 175385000) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-carbamoylnonyl 2,2,2-trifluoroacetate.
| Compound Name | 2-carbamoylnonyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175385000 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-carbamoylnonyl 2,2,2-trifluoroacetate |
| SMILES | CCCCCCCC(COC(=O)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C12H20F3NO3/c1-2-3-4-5-6-7-9(10(16)17)8-19-11(18)12(13,14)15/h9H,2-8H2,1H3,(H2,16,17) |
| InChIKey | ISBCLGLJZGTIIJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|