About 4-(4-aminophenyl)aniline;ethoxyphosphane
4-(4-aminophenyl)aniline;ethoxyphosphane (PubChem CID 175385219) has the molecular formula C14H19N2OP
and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;ethoxyphosphane.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;ethoxyphosphane |
| PubChem CID | 175385219 |
| Molecular Formula | C14H19N2OP |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-(4-aminophenyl)aniline;ethoxyphosphane |
| SMILES | CCOP.Nc1ccc(-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2.C2H7OP/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-3-4/h1-8H,13-14H2;2,4H2,1H3 |
| InChIKey | OUZVWBVPHYGWLD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;ethoxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;ethoxyphosphane?
The IUPAC name of 4-(4-aminophenyl)aniline;ethoxyphosphane (CID 175385219) is 4-(4-aminophenyl)aniline;ethoxyphosphane.
What is the SMILES notation for 4-(4-aminophenyl)aniline;ethoxyphosphane?
The canonical SMILES for 4-(4-aminophenyl)aniline;ethoxyphosphane is CCOP.Nc1ccc(-c2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)aniline;ethoxyphosphane?
The InChIKey is OUZVWBVPHYGWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C2H7OP/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2-3-4/h1-8H,13-14H2;2,4H2,1H3.
What are the key properties of 4-(4-aminophenyl)aniline;ethoxyphosphane?
4-(4-aminophenyl)aniline;ethoxyphosphane has a molecular weight of 262.29 g/mol, XLogP of 3.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;ethoxyphosphane is sourced from PubChem (CID 175385219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).