C26H23F9N4O4 — CID 175386185
7-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-fluoro-4-oxo-N-(1,1,3,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 175386185) has the molecular formula C26H23F9N4O4 and a molecular weight of 626.48 g/mol. Its IUPAC name is 7-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-fluoro-4-oxo-N-(1,1,3,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-fluoro-4-oxo-N-(1,1,3,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 175386185 |
| Molecular Formula | C26H23F9N4O4 |
| Molecular Weight | 626.48 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | 7-[4,4-bis(hydroxymethyl)piperidin-1-yl]-6-fluoro-4-oxo-N-(1,1,3,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NC(C(F)F)C(F)C(F)F)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3CCC(CO)(CO)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C26H23F9N4O4/c27-11-5-14(28)19(15(29)6-11)39-8-13(25(43)36-18(22(34)35)17(31)21(32)33)20(42)12-7-16(30)24(37-23(12)39)38-3-1-26(9-40,10-41)2-4-38/h5-8,17-18,21-22,40-41H,1-4,9-10H2,(H,36,43) |
| InChIKey | UOCKURSWSSXXPF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |