About 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole
3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole (PubChem CID 175393218) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole |
| PubChem CID | 175393218 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole |
| SMILES | Nc1cc2ccccc2cc1C=O.c1ccc2oncc2c1 |
| InChI | InChI=1S/C11H9NO.C7H5NO/c12-11-6-9-4-2-1-3-8(9)5-10(11)7-13;1-2-4-7-6(3-1)5-8-9-7/h1-7H,12H2;1-5H |
| InChIKey | DKUUMVAVLWNWDY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole?
The IUPAC name of 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole (CID 175393218) is 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole.
What is the SMILES notation for 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole?
The canonical SMILES for 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole is Nc1cc2ccccc2cc1C=O.c1ccc2oncc2c1.
What is the InChIKey of 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole?
The InChIKey is DKUUMVAVLWNWDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.C7H5NO/c12-11-6-9-4-2-1-3-8(9)5-10(11)7-13;1-2-4-7-6(3-1)5-8-9-7/h1-7H,12H2;1-5H.
What are the key properties of 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole?
3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole has a molecular weight of 290.32 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminonaphthalene-2-carbaldehyde;1,2-benzoxazole is sourced from PubChem (CID 175393218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).