C8H12N2O4S — CID 22336184
azanium;1,2-benzoxazole;methanesulfonate (PubChem CID 22336184) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is azanium;1,2-benzoxazole;methanesulfonate.
| Compound Name | azanium;1,2-benzoxazole;methanesulfonate |
|---|---|
| PubChem CID | 22336184 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | azanium;1,2-benzoxazole;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].[NH4+].c1ccc2oncc2c1 |
| InChI | InChI=1S/C7H5NO.CH4O3S.H3N/c1-2-4-7-6(3-1)5-8-9-7;1-5(2,3)4;/h1-5H;1H3,(H,2,3,4);1H3 |
| InChIKey | CPXBVKYFISTCRI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|