C15H10N2O3S — CID 174533353
1,3-benzothiazole-2-carboxylic acid;1,2-benzoxazole (PubChem CID 174533353) has the molecular formula C15H10N2O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is 1,3-benzothiazole-2-carboxylic acid;1,2-benzoxazole.
| Compound Name | 1,3-benzothiazole-2-carboxylic acid;1,2-benzoxazole |
|---|---|
| PubChem CID | 174533353 |
| Molecular Formula | C15H10N2O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1,3-benzothiazole-2-carboxylic acid;1,2-benzoxazole |
| SMILES | O=C(O)c1nc2ccccc2s1.c1ccc2oncc2c1 |
| InChI | InChI=1S/C8H5NO2S.C7H5NO/c10-8(11)7-9-5-3-1-2-4-6(5)12-7;1-2-4-7-6(3-1)5-8-9-7/h1-4H,(H,10,11);1-5H |
| InChIKey | SYLLPTNAZAADAY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |