C14H13ClO2 — CID 175393763
5-chloro-5-methoxy-4-phenylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 175393763) has the molecular formula C14H13ClO2 and a molecular weight of 248.71 g/mol. Its IUPAC name is 5-chloro-5-methoxy-4-phenylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 5-chloro-5-methoxy-4-phenylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 175393763 |
| Molecular Formula | C14H13ClO2 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-chloro-5-methoxy-4-phenylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1(Cl)CC(C=O)=CC=C1c1ccccc1 |
| InChI | InChI=1S/C14H13ClO2/c1-17-14(15)9-11(10-16)7-8-13(14)12-5-3-2-4-6-12/h2-8,10H,9H2,1H3 |
| InChIKey | NJWRZSAHIZEKHW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|