C23H17ClF2N2O4S — CID 175396270
6-chloro-3-(3-ethoxycarbonyl-4-fluoro-N-sulfinoanilino)-5-fluoro-1-phenylindole (PubChem CID 175396270) has the molecular formula C23H17ClF2N2O4S and a molecular weight of 490.92 g/mol. Its IUPAC name is 6-chloro-3-(3-ethoxycarbonyl-4-fluoro-N-sulfinoanilino)-5-fluoro-1-phenylindole.
| Compound Name | 6-chloro-3-(3-ethoxycarbonyl-4-fluoro-N-sulfinoanilino)-5-fluoro-1-phenylindole |
|---|---|
| PubChem CID | 175396270 |
| Molecular Formula | C23H17ClF2N2O4S |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 6-chloro-3-(3-ethoxycarbonyl-4-fluoro-N-sulfinoanilino)-5-fluoro-1-phenylindole |
| SMILES | CCOC(=O)c1cc(N(c2cn(-c3ccccc3)c3cc(Cl)c(F)cc23)S(=O)O)ccc1F |
| InChI | InChI=1S/C23H17ClF2N2O4S/c1-2-32-23(29)16-10-15(8-9-19(16)25)28(33(30)31)22-13-27(14-6-4-3-5-7-14)21-12-18(24)20(26)11-17(21)22/h3-13H,2H2,1H3,(H,30,31) |
| InChIKey | NCMDVPSLPNAWPT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|