C27H25NO — CID 175398165
5-ethoxy-1,3,4-trimethyl-2-phenyl-7H-indeno[2,1-c]isoquinoline (PubChem CID 175398165) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-ethoxy-1,3,4-trimethyl-2-phenyl-7H-indeno[2,1-c]isoquinoline.
| Compound Name | 5-ethoxy-1,3,4-trimethyl-2-phenyl-7H-indeno[2,1-c]isoquinoline |
|---|---|
| PubChem CID | 175398165 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 5-ethoxy-1,3,4-trimethyl-2-phenyl-7H-indeno[2,1-c]isoquinoline |
| SMILES | CCOc1nc2c(c3c(C)c(-c4ccccc4)c(C)c(C)c13)-c1ccccc1C2 |
| InChI | InChI=1S/C27H25NO/c1-5-29-27-25-17(3)16(2)23(19-11-7-6-8-12-19)18(4)24(25)26-21-14-10-9-13-20(21)15-22(26)28-27/h6-14H,5,15H2,1-4H3 |
| InChIKey | QAHYEVWXMJUZRP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |