C16H23F3N6O4 — CID 175401728
1-[methyl-[2-[2-oxo-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-yl carbamate (PubChem CID 175401728) has the molecular formula C16H23F3N6O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is 1-[methyl-[2-[2-oxo-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-yl carbamate.
| Compound Name | 1-[methyl-[2-[2-oxo-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-yl carbamate |
|---|---|
| PubChem CID | 175401728 |
| Molecular Formula | C16H23F3N6O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[methyl-[2-[2-oxo-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethoxy]amino]propan-2-yl carbamate |
| SMILES | CC(CN(C)OCCN1CCN(c2ncc(C(F)(F)F)cn2)CC1=O)OC(N)=O |
| InChI | InChI=1S/C16H23F3N6O4/c1-11(29-14(20)27)9-23(2)28-6-5-24-3-4-25(10-13(24)26)15-21-7-12(8-22-15)16(17,18)19/h7-8,11H,3-6,9-10H2,1-2H3,(H2,20,27) |
| InChIKey | ASWPZBRSZZIVET-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|