C22H34O14 — CID 175406908
bis[2-(1,1,1-trihydroxy-4-methyl-3-oxopent-4-en-2-yl)oxyethyl] hexanedioate (PubChem CID 175406908) has the molecular formula C22H34O14 and a molecular weight of 522.50 g/mol. Its IUPAC name is bis[2-(1,1,1-trihydroxy-4-methyl-3-oxopent-4-en-2-yl)oxyethyl] hexanedioate.
| Compound Name | bis[2-(1,1,1-trihydroxy-4-methyl-3-oxopent-4-en-2-yl)oxyethyl] hexanedioate |
|---|---|
| PubChem CID | 175406908 |
| Molecular Formula | C22H34O14 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | bis[2-(1,1,1-trihydroxy-4-methyl-3-oxopent-4-en-2-yl)oxyethyl] hexanedioate |
| SMILES | C=C(C)C(=O)C(OCCOC(=O)CCCCC(=O)OCCOC(C(=O)C(=C)C)C(O)(O)O)C(O)(O)O |
| InChI | InChI=1S/C22H34O14/c1-13(2)17(25)19(21(27,28)29)35-11-9-33-15(23)7-5-6-8-16(24)34-10-12-36-20(22(30,31)32)18(26)14(3)4/h19-20,27-32H,1,3,5-12H2,2,4H3 |
| InChIKey | JRIUQJQSVOYAMM-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 226.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|