C21H20F3N6OP — CID 175411789
1-(2-dimethylphosphorylphenyl)-2-(2-methylindazol-6-yl)-1-[5-(trifluoromethyl)pyrimidin-4-yl]hydrazine (PubChem CID 175411789) has the molecular formula C21H20F3N6OP and a molecular weight of 460.40 g/mol. Its IUPAC name is 1-(2-dimethylphosphorylphenyl)-2-(2-methylindazol-6-yl)-1-[5-(trifluoromethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | 1-(2-dimethylphosphorylphenyl)-2-(2-methylindazol-6-yl)-1-[5-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 175411789 |
| Molecular Formula | C21H20F3N6OP |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 1-(2-dimethylphosphorylphenyl)-2-(2-methylindazol-6-yl)-1-[5-(trifluoromethyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cn1cc2ccc(NN(c3ccccc3P(C)(C)=O)c3ncncc3C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C21H20F3N6OP/c1-29-12-14-8-9-15(10-17(14)28-29)27-30(18-6-4-5-7-19(18)32(2,3)31)20-16(21(22,23)24)11-25-13-26-20/h4-13,27H,1-3H3 |
| InChIKey | KELLYQAQFSEJQI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|