C30H36O8 — CID 175414082
2-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid (PubChem CID 175414082) has the molecular formula C30H36O8 and a molecular weight of 524.61 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid.
| Compound Name | 2-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid |
|---|---|
| PubChem CID | 175414082 |
| Molecular Formula | C30H36O8 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]-4-[8-(2-methylprop-2-enoyloxy)octoxy]benzoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCOc1ccc(C(=O)O)c(-c2ccc(/C=C/C(=O)OC)cc2OC)c1 |
| InChI | InChI=1S/C30H36O8/c1-21(2)30(34)38-18-10-8-6-5-7-9-17-37-23-13-15-25(29(32)33)26(20-23)24-14-11-22(19-27(24)35-3)12-16-28(31)36-4/h11-16,19-20H,1,5-10,17-18H2,2-4H3,(H,32,33)/b16-12+ |
| InChIKey | ZLDSQCAYZRRKHH-FOWTUZBSSA-N |
| XLogP | 6.09 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|