About 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one
8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one (PubChem CID 175416489) has the molecular formula C17H22O3S
and a molecular weight of 306.43 g/mol. Its IUPAC name is 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one.
Molecular Properties
| Compound Name | 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one |
| PubChem CID | 175416489 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one |
| SMILES | CC[C@@H](C)c1cc(C)cc2c(=O)c(C)c(S(=O)CC)oc12 |
| InChI | InChI=1S/C17H22O3S/c1-6-11(4)13-8-10(3)9-14-15(18)12(5)17(20-16(13)14)21(19)7-2/h8-9,11H,6-7H2,1-5H3/t11-,21?/m1/s1 |
| InChIKey | AEVDQZVJGPRCRW-ZIFPNCEFSA-N |
| XLogP | 4.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one?
The IUPAC name of 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one (CID 175416489) is 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one.
What is the SMILES notation for 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one?
The canonical SMILES for 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one is CC[C@@H](C)c1cc(C)cc2c(=O)c(C)c(S(=O)CC)oc12.
What is the InChIKey of 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one?
The InChIKey is AEVDQZVJGPRCRW-ZIFPNCEFSA-N. The full InChI is InChI=1S/C17H22O3S/c1-6-11(4)13-8-10(3)9-14-15(18)12(5)17(20-16(13)14)21(19)7-2/h8-9,11H,6-7H2,1-5H3/t11-,21?/m1/s1.
What are the key properties of 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one?
8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one has a molecular weight of 306.43 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2R)-butan-2-yl]-2-ethylsulfinyl-3,6-dimethylchromen-4-one is sourced from PubChem (CID 175416489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).