C11H15F3O2 — CID 175425299
2-[4-(trifluoromethyl)cyclohexylidene]butanoic acid (PubChem CID 175425299) has the molecular formula C11H15F3O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)cyclohexylidene]butanoic acid.
| Compound Name | 2-[4-(trifluoromethyl)cyclohexylidene]butanoic acid |
|---|---|
| PubChem CID | 175425299 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[4-(trifluoromethyl)cyclohexylidene]butanoic acid |
| SMILES | CCC(C(=O)O)=C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3O2/c1-2-9(10(15)16)7-3-5-8(6-4-7)11(12,13)14/h8H,2-6H2,1H3,(H,15,16)/b9-7- |
| InChIKey | LQJARWJVYNXPBC-CLFYSBASSA-N |
| XLogP | 3.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|