C17H28O2 — CID 70968445
(2Z)-2-(7,8,8-trimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene)butanoic acid (PubChem CID 70968445) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (2Z)-2-(7,8,8-trimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene)butanoic acid.
| Compound Name | (2Z)-2-(7,8,8-trimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene)butanoic acid |
|---|---|
| PubChem CID | 70968445 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (2Z)-2-(7,8,8-trimethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene)butanoic acid |
| SMILES | CC/C(C(=O)O)=C1\CCC2CCC(C)C(C)(C)C2C1 |
| InChI | InChI=1S/C17H28O2/c1-5-14(16(18)19)13-9-8-12-7-6-11(2)17(3,4)15(12)10-13/h11-12,15H,5-10H2,1-4H3,(H,18,19)/b14-13- |
| InChIKey | JDMQWMZFJPXUNY-YPKPFQOOSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|