About 2-benzylidenepiperidin-4-one;pyridine
2-benzylidenepiperidin-4-one;pyridine (PubChem CID 175427623) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-benzylidenepiperidin-4-one;pyridine.
Molecular Properties
| Compound Name | 2-benzylidenepiperidin-4-one;pyridine |
| PubChem CID | 175427623 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-benzylidenepiperidin-4-one;pyridine |
| SMILES | O=C1CCNC(=Cc2ccccc2)C1.c1ccncc1 |
| InChI | InChI=1S/C12H13NO.C5H5N/c14-12-6-7-13-11(9-12)8-10-4-2-1-3-5-10;1-2-4-6-5-3-1/h1-5,8,13H,6-7,9H2;1-5H |
| InChIKey | OWNKARIQKYNVFE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylidenepiperidin-4-one;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylidenepiperidin-4-one;pyridine?
The IUPAC name of 2-benzylidenepiperidin-4-one;pyridine (CID 175427623) is 2-benzylidenepiperidin-4-one;pyridine.
What is the SMILES notation for 2-benzylidenepiperidin-4-one;pyridine?
The canonical SMILES for 2-benzylidenepiperidin-4-one;pyridine is O=C1CCNC(=Cc2ccccc2)C1.c1ccncc1.
What is the InChIKey of 2-benzylidenepiperidin-4-one;pyridine?
The InChIKey is OWNKARIQKYNVFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.C5H5N/c14-12-6-7-13-11(9-12)8-10-4-2-1-3-5-10;1-2-4-6-5-3-1/h1-5,8,13H,6-7,9H2;1-5H.
What are the key properties of 2-benzylidenepiperidin-4-one;pyridine?
2-benzylidenepiperidin-4-one;pyridine has a molecular weight of 266.34 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylidenepiperidin-4-one;pyridine is sourced from PubChem (CID 175427623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).