About 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid
2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid (PubChem CID 175556461) has the molecular formula C17H22FNO3
and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid.
Molecular Properties
| Compound Name | 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid |
| PubChem CID | 175556461 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid |
| SMILES | CCCCC(=O)O.O=C1CCNC(=Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C12H12FNO.C5H10O2/c13-10-3-1-9(2-4-10)7-11-8-12(15)5-6-14-11;1-2-3-4-5(6)7/h1-4,7,14H,5-6,8H2;2-4H2,1H3,(H,6,7) |
| InChIKey | PYIXNFDHGIFLOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid?
The IUPAC name of 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid (CID 175556461) is 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid.
What is the SMILES notation for 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid?
The canonical SMILES for 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid is CCCCC(=O)O.O=C1CCNC(=Cc2ccc(F)cc2)C1.
What is the InChIKey of 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid?
The InChIKey is PYIXNFDHGIFLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO.C5H10O2/c13-10-3-1-9(2-4-10)7-11-8-12(15)5-6-14-11;1-2-3-4-5(6)7/h1-4,7,14H,5-6,8H2;2-4H2,1H3,(H,6,7).
What are the key properties of 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid?
2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid has a molecular weight of 307.37 g/mol, XLogP of 3.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)methylidene]piperidin-4-one;pentanoic acid is sourced from PubChem (CID 175556461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).