C7H14O4P+ — CID 175429579
hydroxy-oxo-(2,2,3-trimethylbutanoyloxy)phosphanium (PubChem CID 175429579) has the molecular formula C7H14O4P+ and a molecular weight of 193.16 g/mol. Its IUPAC name is hydroxy-oxo-(2,2,3-trimethylbutanoyloxy)phosphanium.
| Compound Name | hydroxy-oxo-(2,2,3-trimethylbutanoyloxy)phosphanium |
|---|---|
| PubChem CID | 175429579 |
| Molecular Formula | C7H14O4P+ |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | hydroxy-oxo-(2,2,3-trimethylbutanoyloxy)phosphanium |
| SMILES | CC(C)C(C)(C)C(=O)O[P+](=O)O |
| InChI | InChI=1S/C7H13O4P/c1-5(2)7(3,4)6(8)11-12(9)10/h5H,1-4H3/p+1 |
| InChIKey | BGUYYZKCEOOTNY-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|