C11H20N2O3 — CID 165094607
[methyl(methylidenecarbamoyl)amino]methyl 2,2,3-trimethylbutanoate (PubChem CID 165094607) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is [methyl(methylidenecarbamoyl)amino]methyl 2,2,3-trimethylbutanoate.
| Compound Name | [methyl(methylidenecarbamoyl)amino]methyl 2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 165094607 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [methyl(methylidenecarbamoyl)amino]methyl 2,2,3-trimethylbutanoate |
| SMILES | C=NC(=O)N(C)COC(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C11H20N2O3/c1-8(2)11(3,4)9(14)16-7-13(6)10(15)12-5/h8H,5,7H2,1-4,6H3 |
| InChIKey | XGZVPVBGUKKZNF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|