About azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol
azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol (PubChem CID 175430159) has the molecular formula C17H33NO6S
and a molecular weight of 379.52 g/mol. Its IUPAC name is azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol.
Molecular Properties
| Compound Name | azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol |
| PubChem CID | 175430159 |
| Molecular Formula | C17H33NO6S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol |
| SMILES | CCCCCCCCCc1cccc(O)c1.N.O=S(=O)(O)OCCO |
| InChI | InChI=1S/C15H24O.C2H6O5S.H3N/c1-2-3-4-5-6-7-8-10-14-11-9-12-15(16)13-14;3-1-2-7-8(4,5)6;/h9,11-13,16H,2-8,10H2,1H3;3H,1-2H2,(H,4,5,6);1H3 |
| InChIKey | HAZCSXDGFMVYDX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol?
The IUPAC name of azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol (CID 175430159) is azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol.
What is the SMILES notation for azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol?
The canonical SMILES for azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol is CCCCCCCCCc1cccc(O)c1.N.O=S(=O)(O)OCCO.
What is the InChIKey of azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol?
The InChIKey is HAZCSXDGFMVYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C2H6O5S.H3N/c1-2-3-4-5-6-7-8-10-14-11-9-12-15(16)13-14;3-1-2-7-8(4,5)6;/h9,11-13,16H,2-8,10H2,1H3;3H,1-2H2,(H,4,5,6);1H3.
What are the key properties of azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol?
azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol has a molecular weight of 379.52 g/mol, XLogP of 3.65, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxyethyl hydrogen sulfate;3-nonylphenol is sourced from PubChem (CID 175430159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).