About 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid
3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid (PubChem CID 175444668) has the molecular formula C17H12F3N3O4S
and a molecular weight of 411.36 g/mol. Its IUPAC name is 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid |
| PubChem CID | 175444668 |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(-c2nc3cc(SC(F)(F)F)ccc3n2C)nc1C(=O)O |
| InChI | InChI=1S/C17H12F3N3O4S/c1-7-5-9(15(24)25)13(22-12(7)16(26)27)14-21-10-6-8(28-17(18,19)20)3-4-11(10)23(14)2/h3-6H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | FBDVQQKAIYQKDU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid?
The IUPAC name of 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid (CID 175444668) is 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid.
What is the SMILES notation for 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid?
The canonical SMILES for 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid is Cc1cc(C(=O)O)c(-c2nc3cc(SC(F)(F)F)ccc3n2C)nc1C(=O)O.
What is the InChIKey of 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid?
The InChIKey is FBDVQQKAIYQKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N3O4S/c1-7-5-9(15(24)25)13(22-12(7)16(26)27)14-21-10-6-8(28-17(18,19)20)3-4-11(10)23(14)2/h3-6H,1-2H3,(H,24,25)(H,26,27).
What are the key properties of 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid?
3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid has a molecular weight of 411.36 g/mol, XLogP of 3.95, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-2,5-dicarboxylic acid is sourced from PubChem (CID 175444668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).