C20H20F3N5O2S — CID 169003699
6-[(E)-ethoxyiminomethyl]-N,N-dimethyl-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxamide (PubChem CID 169003699) has the molecular formula C20H20F3N5O2S and a molecular weight of 451.47 g/mol. Its IUPAC name is 6-[(E)-ethoxyiminomethyl]-N,N-dimethyl-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-[(E)-ethoxyiminomethyl]-N,N-dimethyl-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 169003699 |
| Molecular Formula | C20H20F3N5O2S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 6-[(E)-ethoxyiminomethyl]-N,N-dimethyl-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxamide |
| SMILES | CCO/N=C/c1ccc(C(=O)N(C)C)c(-c2nc3cc(SC(F)(F)F)ccc3n2C)n1 |
| InChI | InChI=1S/C20H20F3N5O2S/c1-5-30-24-11-12-6-8-14(19(29)27(2)3)17(25-12)18-26-15-10-13(31-20(21,22)23)7-9-16(15)28(18)4/h6-11H,5H2,1-4H3/b24-11+ |
| InChIKey | NIUZJHBWCWVROL-BHGWPJFGSA-N |
| XLogP | 4.32 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|