C17H27NO2Si — CID 175445190
(4S)-4-[4-[tert-butyl(dimethyl)silyl]phenyl]-5,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 175445190) has the molecular formula C17H27NO2Si and a molecular weight of 305.49 g/mol. Its IUPAC name is (4S)-4-[4-[tert-butyl(dimethyl)silyl]phenyl]-5,5-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[4-[tert-butyl(dimethyl)silyl]phenyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 175445190 |
| Molecular Formula | C17H27NO2Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (4S)-4-[4-[tert-butyl(dimethyl)silyl]phenyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N[C@H]1c1ccc([Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27NO2Si/c1-16(2,3)21(6,7)13-10-8-12(9-11-13)14-17(4,5)20-15(19)18-14/h8-11,14H,1-7H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | JAOXPAARFGPHRO-AWEZNQCLSA-N |
| XLogP | 3.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|