C13H13NO2 — CID 170329281
(4R)-4-(4-ethynylphenyl)-5,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 170329281) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (4R)-4-(4-ethynylphenyl)-5,5-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(4-ethynylphenyl)-5,5-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 170329281 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (4R)-4-(4-ethynylphenyl)-5,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | C#Cc1ccc([C@H]2NC(=O)OC2(C)C)cc1 |
| InChI | InChI=1S/C13H13NO2/c1-4-9-5-7-10(8-6-9)11-13(2,3)16-12(15)14-11/h1,5-8,11H,2-3H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | JNQMVCXQHCAKIS-LLVKDONJSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|