C15H14O2 — CID 59873055
4-(4-ethynylphenyl)-3,5,5-trimethylfuran-2-one (PubChem CID 59873055) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-(4-ethynylphenyl)-3,5,5-trimethylfuran-2-one.
| Compound Name | 4-(4-ethynylphenyl)-3,5,5-trimethylfuran-2-one |
|---|---|
| PubChem CID | 59873055 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(4-ethynylphenyl)-3,5,5-trimethylfuran-2-one |
| SMILES | C#Cc1ccc(C2=C(C)C(=O)OC2(C)C)cc1 |
| InChI | InChI=1S/C15H14O2/c1-5-11-6-8-12(9-7-11)13-10(2)14(16)17-15(13,3)4/h1,6-9H,2-4H3 |
| InChIKey | MOWIPCBQDSIRHU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|