About N-iodo-3-oxobutanamide;hydrochloride
N-iodo-3-oxobutanamide;hydrochloride (PubChem CID 175454185) has the molecular formula C4H7ClINO2
and a molecular weight of 263.46 g/mol. Its IUPAC name is N-iodo-3-oxobutanamide;hydrochloride.
Molecular Properties
| Compound Name | N-iodo-3-oxobutanamide;hydrochloride |
| PubChem CID | 175454185 |
| Molecular Formula | C4H7ClINO2 |
| Molecular Weight | 263.46 g/mol |
| Exact Mass | 262.92 |
| IUPAC Name | N-iodo-3-oxobutanamide;hydrochloride |
| SMILES | CC(=O)CC(=O)NI.Cl |
| InChI | InChI=1S/C4H6INO2.ClH/c1-3(7)2-4(8)6-5;/h2H2,1H3,(H,6,8);1H |
| InChIKey | SADIFIOALWFTGZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-3-oxobutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-3-oxobutanamide;hydrochloride?
The IUPAC name of N-iodo-3-oxobutanamide;hydrochloride (CID 175454185) is N-iodo-3-oxobutanamide;hydrochloride.
What is the SMILES notation for N-iodo-3-oxobutanamide;hydrochloride?
The canonical SMILES for N-iodo-3-oxobutanamide;hydrochloride is CC(=O)CC(=O)NI.Cl.
What is the InChIKey of N-iodo-3-oxobutanamide;hydrochloride?
The InChIKey is SADIFIOALWFTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6INO2.ClH/c1-3(7)2-4(8)6-5;/h2H2,1H3,(H,6,8);1H.
What are the key properties of N-iodo-3-oxobutanamide;hydrochloride?
N-iodo-3-oxobutanamide;hydrochloride has a molecular weight of 263.46 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-3-oxobutanamide;hydrochloride is sourced from PubChem (CID 175454185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).