About 2-(diazidomethoxy)butane;oxolane
2-(diazidomethoxy)butane;oxolane (PubChem CID 175458633) has the molecular formula C9H18N6O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(diazidomethoxy)butane;oxolane.
Molecular Properties
| Compound Name | 2-(diazidomethoxy)butane;oxolane |
| PubChem CID | 175458633 |
| Molecular Formula | C9H18N6O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-(diazidomethoxy)butane;oxolane |
| SMILES | C1CCOC1.CCC(C)OC(N=[N+]=[N-])N=[N+]=[N-] |
| InChI | InChI=1S/C5H10N6O.C4H8O/c1-3-4(2)12-5(8-10-6)9-11-7;1-2-4-5-3-1/h4-5H,3H2,1-2H3;1-4H2 |
| InChIKey | JEEOOHAWZZLLSX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(diazidomethoxy)butane;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diazidomethoxy)butane;oxolane?
The IUPAC name of 2-(diazidomethoxy)butane;oxolane (CID 175458633) is 2-(diazidomethoxy)butane;oxolane.
What is the SMILES notation for 2-(diazidomethoxy)butane;oxolane?
The canonical SMILES for 2-(diazidomethoxy)butane;oxolane is C1CCOC1.CCC(C)OC(N=[N+]=[N-])N=[N+]=[N-].
What is the InChIKey of 2-(diazidomethoxy)butane;oxolane?
The InChIKey is JEEOOHAWZZLLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N6O.C4H8O/c1-3-4(2)12-5(8-10-6)9-11-7;1-2-4-5-3-1/h4-5H,3H2,1-2H3;1-4H2.
What are the key properties of 2-(diazidomethoxy)butane;oxolane?
2-(diazidomethoxy)butane;oxolane has a molecular weight of 242.28 g/mol, XLogP of 3.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diazidomethoxy)butane;oxolane is sourced from PubChem (CID 175458633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).