C17H14F3NO3 — CID 175459377
3-[1-(3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one (PubChem CID 175459377) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is 3-[1-(3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one.
| Compound Name | 3-[1-(3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one |
|---|---|
| PubChem CID | 175459377 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-[1-(3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one |
| SMILES | Cc1cc(C)c(C(O)(c2cc3ccccc3oc2=O)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C17H14F3NO3/c1-9-7-10(2)21-14(9)16(23,17(18,19)20)12-8-11-5-3-4-6-13(11)24-15(12)22/h3-8,21,23H,1-2H3 |
| InChIKey | XMZFOUGGJLYYFZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|