C19H14F3NO3 — CID 91688893
2,2,2-trifluoro-N-methyl-N-[2-methyl-5-(2-oxochromen-3-yl)phenyl]acetamide (PubChem CID 91688893) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[2-methyl-5-(2-oxochromen-3-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[2-methyl-5-(2-oxochromen-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 91688893 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[2-methyl-5-(2-oxochromen-3-yl)phenyl]acetamide |
| SMILES | Cc1ccc(-c2cc3ccccc3oc2=O)cc1N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO3/c1-11-7-8-12(10-15(11)23(2)18(25)19(20,21)22)14-9-13-5-3-4-6-16(13)26-17(14)24/h3-10H,1-2H3 |
| InChIKey | RKOYRTUZPFHTGY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|